| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007302 |
| Definition | Thiorphan is the active metabolite of the antidieuretic drug racecadotril. It has shown inhibitory activity against various metallo-beta-lactamases. |
| SMILES | O=C(O)CNC(=O)C(CS)Cc1ccccc1 |
| PubChem | 3132 |
| CHEBI | 9568 |
| CAS | 76721-89-6 |
| ChEMBL | CHEMBL10247 |
| AMR Gene Family | NDM beta-lactamase, VIM beta-lactamase, IMP beta-lactamase |
| Drug Class | penicillin beta-lactam, cephalosporin, carbapenem |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 25 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + hydrolysis of beta-lactam antibiotic by metallo-beta-lactamase + beta-lactamase + antibiotic molecule + resistance-modifying agents + inhibitor of antibiotic resistance mechanism + beta-lactam antibiotic + class B (metallo-) beta-lactamase + subclass B1 (metallo-) beta-lactamase + beta-lactamase inhibitor + penicillin beta-lactam [Drug Class] + cephalosporin [Drug Class] + carbapenem [Drug Class] + metallo-beta-lactamase inhibitor + imipenem [Antibiotic] + NDM beta-lactamase [AMR Gene Family] + VIM beta-lactamase [AMR Gene Family] + IMP beta-lactamase [AMR Gene Family] + meropenem [Antibiotic] + ertapenem [Antibiotic] |
| Parent Term(s) | 4 ontology terms | Show + is_small_molecule_inhibitor_of NDM-1 + is_small_molecule_inhibitor_of IMP-7 + is_small_molecule_inhibitor_of VIM-1 + unclassified metallo-beta-lactamase inhibitor |
| Publications | González-Bello C, et al. 2020. J Med Chem 63(5):1859-1881 β-Lactamase Inhibitors To Restore the Efficacy of Antibiotics against Superbugs. (PMID 31663735) |
| Curator | Description | Most Recent Edit |
|---|