| Ontology | CARD's Antibiotic Resistance Ontology |
| Accession | ARO:3007140 |
| Synonym(s) | DMPS |
| Definition | Unithiol is an experimental chelating agent that forms complexes with heavy metals. It has been shown to inhibit the action of the metallo-beta-lactamases NDM-1 and VIM-2. |
| SMILES | O.O=S(=O)([O-])CC(S)CS.[Na+] |
| PubChem | 2724039 |
| CHEBI | 888 |
| CAS | 74-61-3 |
| ChEMBL | CHEMBL1569746 |
| AMR Gene Family | NDM beta-lactamase, VIM beta-lactamase |
| Drug Class | penicillin beta-lactam, cephalosporin, carbapenem |
| Resistance Mechanism | antibiotic inactivation |
| Classification | 24 ontology terms | Show + process or component of antibiotic biology or chemistry + mechanism of antibiotic resistance + determinant of antibiotic resistance + antibiotic inactivation [Resistance Mechanism] + antibiotic inactivation enzyme + hydrolysis of antibiotic conferring resistance + hydrolysis of beta-lactam antibiotic by metallo-beta-lactamase + beta-lactamase + antibiotic molecule + resistance-modifying agents + inhibitor of antibiotic resistance mechanism + beta-lactam antibiotic + class B (metallo-) beta-lactamase + subclass B1 (metallo-) beta-lactamase + beta-lactamase inhibitor + penicillin beta-lactam [Drug Class] + cephalosporin [Drug Class] + carbapenem [Drug Class] + metallo-beta-lactamase inhibitor + imipenem [Antibiotic] + NDM beta-lactamase [AMR Gene Family] + VIM beta-lactamase [AMR Gene Family] + meropenem [Antibiotic] + ertapenem [Antibiotic] |
| Parent Term(s) | 3 ontology terms | Show + is_small_molecule_inhibitor_of NDM-1 + is_small_molecule_inhibitor_of VIM-2 + unclassified metallo-beta-lactamase inhibitor |
| Publications | Grigorenko VG, et al. 2022. Int J Mol Sci 23(3): Drug Repurposing of the Unithiol: Inhibition of Metallo-β-Lactamases for the Treatment of Carbapenem-Resistant Gram-Negative Bacterial Infections. (PMID 35163756) |
| Curator | Description | Most Recent Edit |
|---|